Molecular Definition

Canonical SMILES COc1ccc(cn1)c2ccc(Cn3c(CC(C)(C)C(=O)O)c(SC(C)(C)C)c4cc(OCc5cn6ccccc6n5)ccc34)cc2
Formula C38H40N4O4S
Molecular Weight 648.81 da
Stereocenters 0/0