Molecular Definition

Canonical SMILES CC(C)Cc1ccc(cc1)[C@@H](C)C(=O)NS(=O)(=O)C
Formula C14H21NO3S
Molecular Weight 283.39 da
Stereocenters 1/1