Molecular Definition

Canonical SMILES N[C@@H](CNC(=O)CBr)C(=O)O
Formula C5H9BrN2O3
Molecular Weight 225.04 da
Stereocenters 1/1