Target Relevance

Molecular Definition

Canonical SMILES Cc1cc2ncn(CC(=O)Nc3ncc(s3)C4CCC4)c2cc1C
Formula C18H20N4OS
Molecular Weight 340.44 da
Stereocenters 0/0