Molecular Definition

Canonical SMILES NCCCCn1c(SCCc2c[nH]c3c(Cl)cccc23)nnc1c4ccc5ccccc5n4
Formula C25H25ClN6S
Molecular Weight 477.02 da
Stereocenters 0/0