Molecular Definition

Canonical SMILES CCN(CC)c1ccc2c(Oc3cc(ccc3C24N(CCc5ccc(cc5)S(=O)(=O)N)C(=O)c6ccccc46)N(CC)CC)c1
Formula C36H40N4O4S
Molecular Weight 624.79 da
Stereocenters 0/0