Target Relevance

Molecular Definition

Canonical SMILES Cc1c(CC(C)(C)C(=O)O)n(Cc2ccc(Cl)cc2)c3ccc(cc13)c4ccc(c(F)c4)c5cnccn5
Formula C31H27ClFN3O2
Molecular Weight 528.02 da
Stereocenters 0/0