Target Relevance

Molecular Definition

Canonical SMILES Nc1ncnc2c1ncn2[C@@H]3O[C@H](COP(=O)(S)OCC(COP(=O)(S)OC[C@H]4O[C@H]([C@H](O)[C@@H]4O)n5cnc6c(N)ncnc56)OP(=O)(S)OC[C@H]7O[C@H]([C@H](O)[C@@H]7O)n8cnc9c(N)ncnc89)[C@@H](O)[C@H]3O
Formula C33H44N15O18P3S3
Molecular Weight 1127.91 da
Stereocenters 12/12