Target Relevance

Molecular Definition

Canonical SMILES Nc1ncnc2c1ncn2[C@@H]3O[C@H](COP(=O)(S)OCC(O)COP(=O)(S)OC[C@H]4O[C@H]([C@H](O)[C@@H]4O)n5cnc6c(N)ncnc56)[C@@H](O)[C@H]3O
Formula C23H32N10O13P2S2
Molecular Weight 782.64 da
Stereocenters 8/8