Molecular Definition

Canonical SMILES ONC(=O)C1(CCN(CC1)C2CC2)S(=O)(=O)c3ccc(Oc4ccc5OCOc5c4)cc3
Formula C22H24N2O7S
Molecular Weight 460.50 da
Stereocenters 0/0