Target Relevance

Molecular Definition

Canonical SMILES NC(=N)c1sc2cc(ccc2c1Cl)C#Cc3ccccc3
Formula C17H11ClN2S
Molecular Weight 310.80 da
Stereocenters 0/0