Molecular Definition

Canonical SMILES CCc1oc2c(Br)c(O)c(Br)cc2c1C(=O)c3ccc(OC)cc3
Formula C18H14Br2O4
Molecular Weight 454.11 da
Stereocenters 0/0