Molecular Definition

Canonical SMILES OC(=O)c1ccc(COc2cccc(\C=C\3/S\C(=N/c4ccccc4)\N(Cc5ccc(cc5)C(=O)O)C3=O)c2)cc1
Formula C32H24N2O6S
Molecular Weight 564.61 da
Stereocenters 0/0