Target Relevance

Molecular Definition

Canonical SMILES COc1ccc(\C=N\N=C(/S)\Cc2ccccc2)c(O)c1
Formula C16H16N2O2S
Molecular Weight 300.38 da
Stereocenters 0/0