Molecular Definition

Canonical SMILES CCCn1cc2c(nc(NC(=O)Nc3ccccc3OC)n4nc(nc24)c5occc5)n1
Formula C21H20N8O3
Molecular Weight 432.44 da
Stereocenters 0/0