Target Relevance

Molecular Definition

Canonical SMILES CN(CC(=O)NC1CCN(CC1)C(=O)c2ccc3ccccc3c2)C(=O)c4cc5ccccc5cc4C(=O)C(c6cccc7ccccc67)P(=O)(O)O
Formula C42H38N3O7P
Molecular Weight 727.74 da
Stereocenters 0/1