Target Relevance

Molecular Definition

Canonical SMILES CN(CC(=O)NCC(c1ccccc1)c2ccccc2)C(=O)c3cc4ccccc4cc3C(=O)C(c5cccc6ccccc56)P(=O)(O)O
Formula C40H35N2O6P
Molecular Weight 670.69 da
Stereocenters 0/1