Molecular Definition

Canonical SMILES COC(=O)Nc1cccc(CCN2CCN(CC2)c3cccc4nc(C)ccc34)c1
Formula C24H28N4O2
Molecular Weight 404.50 da
Stereocenters 0/0