Molecular Definition

Canonical SMILES NC(=O)c1cc(C(=O)N)n(n1)c2cccc(c2)c3ccccc3C(F)(F)F
Formula C18H13F3N4O2
Molecular Weight 374.32 da
Stereocenters 0/0