Target Relevance

Molecular Definition

Canonical SMILES CCN(C\C=C\C#CC(C)(C)C)Cc1cccc(OC[Si](C)(C)c2ccc(cc2)C#N)c1
Formula C28H36N2OSi
Molecular Weight 444.68 da
Stereocenters 0/0