Target Relevance

Molecular Definition

Canonical SMILES COC1=CC(=O)N2CC(Oc3cccc1c23)C4=NCCN4
Formula C15H15N3O3
Molecular Weight 285.30 da
Stereocenters 0/1