Molecular Definition

Canonical SMILES COc1ccc(cc1)c2csc(NC(=O)C3CCCCN3S(=O)(=O)c4ccccc4)n2
Formula C22H23N3O4S2
Molecular Weight 457.57 da
Stereocenters 0/1