Molecular Definition

Canonical SMILES NS(=O)(=O)c1ccc(NC(=NC2CCCCC2)S)cc1
Formula C13H19N3O2S2
Molecular Weight 313.44 da
Stereocenters 0/0