Target Relevance

Molecular Definition

Canonical SMILES CC(C)(F)C[C@H](N[C@@H](c1ccc(cc1)c2ccc(cc2)S(=O)(=O)C)C(F)(F)F)C(=O)N[C@@H](Cc3ccccc3)C#N
Formula C30H31F4N3O3S
Molecular Weight 589.64 da
Stereocenters 3/3