Target Relevance

Molecular Definition

Canonical SMILES CC(=O)Nc1cccc(OCC(O)CNC2CCN(CC2)c3ncnc4scc(c5ccccc5)c34)c1
Formula C28H31N5O3S
Molecular Weight 517.64 da
Stereocenters 0/1