Molecular Definition

Canonical SMILES NCc1ccn(c1)c2cc3N(CC(=O)O)C(=O)C(=O)Nc3cc2[N+](=O)[O-]
Formula C15H13N5O6
Molecular Weight 359.29 da
Stereocenters 0/0