Target Relevance

Molecular Definition

Canonical SMILES FC(F)(F)c1cn2CCN(Cc2n1)C(=O)C[C@@H]3C[C@H](NC3=O)C(=O)N4CCC[C@H]4C#N
Formula C19H21F3N6O3
Molecular Weight 438.40 da
Stereocenters 3/3