Molecular Definition

Canonical SMILES CCCCCCN1CCN(C(C1)C(=O)NO)S(=O)(=O)c2ccc(OC)cc2
Formula C18H29N3O5S
Molecular Weight 399.51 da
Stereocenters 0/1