Molecular Definition

Canonical SMILES CCOC(=O)C1=Cc2cc(C)ccc2CC1=O
Formula C14H14O3
Molecular Weight 230.26 da
Stereocenters 0/0