Molecular Definition

Canonical SMILES Clc1ccc(CSC(Cn2ccnc2)c3ccc(Cl)cc3Cl)cc1
Formula C18H15Cl3N2S
Molecular Weight 397.75 da
Stereocenters 0/1