Molecular Definition

Canonical SMILES N[C@@H](CN1C=C(C(=O)NC1=O)[N+](=O)[O-])C(=O)O
Formula C7H8N4O6
Molecular Weight 244.16 da
Stereocenters 1/1