Target Relevance

Molecular Definition

Canonical SMILES Cc1ccc(C)c(c1)S(=O)(=O)c2nnn3c4ccsc4c(N)nc23
Formula C15H13N5O2S2
Molecular Weight 359.43 da
Stereocenters 0/0