Molecular Definition

Canonical SMILES COc1cc(N)[nH]c2nc(c3ccc(F)cc3)c(c4ccncc4)c12
Formula C19H15FN4O
Molecular Weight 334.35 da
Stereocenters 0/0