Molecular Definition

Canonical SMILES CCOC(=O)CCCCCOc1ccc2C(=O)C(=COc2c1)c3ccc(O)cc3
Formula C23H24O6
Molecular Weight 396.43 da
Stereocenters 0/0