Target Relevance

Molecular Definition

Canonical SMILES CCC(C)(C)Cc1c[nH]c(CCc2ccc(cc2)c3csnn3)n1
Formula C19H24N4S
Molecular Weight 340.49 da
Stereocenters 0/0