Target Relevance

Molecular Definition

Canonical SMILES CC(CN1CCCC(C1)C(=O)N2CCN(CC2)c3ccc(cc3)[N+](=O)[O-])Cc4ccc5OCOc5c4
Formula C27H34N4O5
Molecular Weight 494.58 da
Stereocenters 0/2