Target Relevance

Molecular Definition

Canonical SMILES CC(C)CC(NC(=O)[C@@H](CCC(=O)O)Oc1cccc2ccccc12)C(=O)N[C@H]3CC(=O)OC3O
Formula C25H30N2O8
Molecular Weight 486.51 da
Stereocenters 2/4