Target Relevance

Molecular Definition

Canonical SMILES N#Cc1ccc2c(c1)CN([C@@H](CN2Cc1[nH]cnc1)Cc1ccccc1)S(=O)(=O)c1cccs1
Formula C25H23N5O2S2
Molecular Weight 489.61 da
Stereocenters 1/1