Target Relevance

Molecular Definition

Canonical SMILES CN([C@H]1CN(C[C@@H]1c1ccc(cc1)N1CCN(CC1)S(=O)(=O)C)C1CCc2c1c(F)ccc2)C
Formula C26H35FN4O2S
Molecular Weight 486.65 da
Stereocenters 2/3