Molecular Definition

Canonical SMILES NC(=N)c1ccc2c(c1)ccc(c2)C1CC1c1ccc2c(c1)C(C(C)C)N(CC2)C
Formula C27H31N3
Molecular Weight 397.56 da
Stereocenters 0/3