Molecular Definition

Canonical SMILES OC(CN1C=CN=C1)(P(O)(O)=O)P(O)(O)=O
Formula C5H10N2O7P2
Molecular Weight 272.09 da
Stereocenters 0/0