Molecular Definition

Canonical SMILES COc1cc(ccc1Cc1cn(c2c1cc(cc2)NC(=O)OC1CCCC1)C)C(=O)NS(=O)(=O)c1ccccc1C
Formula C31H33N3O6S
Molecular Weight 575.68 da
Stereocenters 0/0