Molecular Definition

Canonical SMILES OC[C@@H]1N(C)CC[C@H]1c1c(O)cc(c2c1oc(cc2=O)c1ccc(cc1Cl)C(F)(F)F)O
Formula C22H19ClF3NO5
Molecular Weight 469.84 da
Stereocenters 2/2