Molecular Definition

Canonical SMILES CNCC1=CN(C(=C1)C1=CC=CC=C1F)S(=O)(=O)C1=CC=CN=C1
Formula C17H16FN3O2S
Molecular Weight 345.39 da
Stereocenters 0/0