Molecular Definition

Canonical SMILES OCC1=C(O)C=CC(=C1)[C@@H](O)CNCCCCCCOCCOCC1=C(Cl)C=CC=C1Cl
Formula C24H33Cl2NO5
Molecular Weight 486.43 da
Stereocenters 1/1