Target Relevance

Molecular Definition

Canonical SMILES CC(C)(C)NCC(O)C1=C(Cl)C=CC=C1
Formula C12H18ClNO
Molecular Weight 227.73 da
Stereocenters 0/1