Molecular Definition

Canonical SMILES [H][C@]12CC3=CC=C(OC4=C5C(CC[N+](C)(C)[C@]5([H])CC5=CC=C(O)C(OC6=CC1=C(CCN2C)C=C6OC)=C5)=CC(OC)=C4O)C=C3
Formula C37H41N2O6
Molecular Weight 609.73 da
Stereocenters 2/3