Molecular Definition

Canonical SMILES NS(=O)(=O)c1cc2c(NC(NS2(=O)=O)C(Cl)Cl)cc1Cl
Formula C8H8Cl3N3O4S2
Molecular Weight 380.66 da
Stereocenters 0/1