Target Relevance

Molecular Definition

Canonical SMILES [H][C@@]12C[C@H]3OC(C)(C)O[C@@]3(C(=O)COC(=O)CC(C)(C)C)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)C=C[C@]12C
Formula C30H41FO7
Molecular Weight 532.64 da
Stereocenters 8/8