Molecular Definition

Canonical SMILES C/C(=C\C=C\C(=C\C(=O)O)\C)/C=C/C1=C(C)CCCC1(C)C
Formula C20H28O2
Molecular Weight 300.44 da
Stereocenters 0/0